C16H12O8 — CID 89313796
5-acetyl-4-(6-acetyl-2,3,4-trihydroxyphenyl)-3-hydroxycyclohexa-3,5-diene-1,2-dione (PubChem CID 89313796) has the molecular formula C16H12O8 and a molecular weight of 332.26 g/mol. Its IUPAC name is 5-acetyl-4-(6-acetyl-2,3,4-trihydroxyphenyl)-3-hydroxycyclohexa-3,5-diene-1,2-dione.
| Compound Name | 5-acetyl-4-(6-acetyl-2,3,4-trihydroxyphenyl)-3-hydroxycyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 89313796 |
| Molecular Formula | C16H12O8 |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 5-acetyl-4-(6-acetyl-2,3,4-trihydroxyphenyl)-3-hydroxycyclohexa-3,5-diene-1,2-dione |
| SMILES | CC(=O)C1=CC(=O)C(=O)C(O)=C1c1c(C(C)=O)cc(O)c(O)c1O |
| InChI | InChI=1S/C16H12O8/c1-5(17)7-3-9(19)13(21)15(23)11(7)12-8(6(2)18)4-10(20)14(22)16(12)24/h3-4,19,21,23-24H,1-2H3 |
| InChIKey | SGUGSUYBPLKHMQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'} |
|---|