C26H36O5 — CID 89313909
(1R,7S,9E,15S,17R)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-15-methyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one (PubChem CID 89313909) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is (1R,7S,9E,15S,17R)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-15-methyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one.
| Compound Name | (1R,7S,9E,15S,17R)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-15-methyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one |
|---|---|
| PubChem CID | 89313909 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | (1R,7S,9E,15S,17R)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-15-methyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-9,19-dien-3-yn-5-one |
| SMILES | C=C1CC/C=C/C[C@@H]([C@@H]2COC(C)(C)O2)OC(=O)C#CC[C@@H]2C=CC[C@@H](C[C@@H](C)C1)O2 |
| InChI | InChI=1S/C26H36O5/c1-19-10-6-5-7-14-23(24-18-28-26(3,4)31-24)30-25(27)15-9-12-21-11-8-13-22(29-21)17-20(2)16-19/h5,7-8,11,20-24H,1,6,10,12-14,16-18H2,2-4H3/b7-5+/t20-,21-,22-,23-,24-/m0/s1 |
| InChIKey | MTEDMARGAZPRHM-JBARZCRUSA-N |
| XLogP | 4.87 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|