C31H40O3Si — CID 89313920
hydroxy-[8-[(2R,3S,6R)-3-methoxy-6-prop-2-ynyl-3,6-dihydro-2H-pyran-2-yl]-2-methyl-5-methylideneoctan-2-yl]-diphenylsilane (PubChem CID 89313920) has the molecular formula C31H40O3Si and a molecular weight of 488.74 g/mol. Its IUPAC name is hydroxy-[8-[(2R,3S,6R)-3-methoxy-6-prop-2-ynyl-3,6-dihydro-2H-pyran-2-yl]-2-methyl-5-methylideneoctan-2-yl]-diphenylsilane.
| Compound Name | hydroxy-[8-[(2R,3S,6R)-3-methoxy-6-prop-2-ynyl-3,6-dihydro-2H-pyran-2-yl]-2-methyl-5-methylideneoctan-2-yl]-diphenylsilane |
|---|---|
| PubChem CID | 89313920 |
| Molecular Formula | C31H40O3Si |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | hydroxy-[8-[(2R,3S,6R)-3-methoxy-6-prop-2-ynyl-3,6-dihydro-2H-pyran-2-yl]-2-methyl-5-methylideneoctan-2-yl]-diphenylsilane |
| SMILES | C#CC[C@@H]1C=C[C@H](OC)[C@@H](CCCC(=C)CCC(C)(C)[Si](O)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C31H40O3Si/c1-6-14-26-21-22-29(33-5)30(34-26)20-13-15-25(2)23-24-31(3,4)35(32,27-16-9-7-10-17-27)28-18-11-8-12-19-28/h1,7-12,16-19,21-22,26,29-30,32H,2,13-15,20,23-24H2,3-5H3/t26-,29+,30-/m1/s1 |
| InChIKey | JJAXNRIVWLYHJR-JJZPZGAKSA-N |
| XLogP | 5.39 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|