C10H16O6S3 — CID 89314003
4,5-bis(prop-2-enylsulfinylmethyl)-1,3,2-dioxathiolane 2,2-dioxide (PubChem CID 89314003) has the molecular formula C10H16O6S3 and a molecular weight of 328.43 g/mol. Its IUPAC name is 4,5-bis(prop-2-enylsulfinylmethyl)-1,3,2-dioxathiolane 2,2-dioxide.
| Compound Name | 4,5-bis(prop-2-enylsulfinylmethyl)-1,3,2-dioxathiolane 2,2-dioxide |
|---|---|
| PubChem CID | 89314003 |
| Molecular Formula | C10H16O6S3 |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 4,5-bis(prop-2-enylsulfinylmethyl)-1,3,2-dioxathiolane 2,2-dioxide |
| SMILES | C=CCS(=O)CC1OS(=O)(=O)OC1CS(=O)CC=C |
| InChI | InChI=1S/C10H16O6S3/c1-3-5-17(11)7-9-10(8-18(12)6-4-2)16-19(13,14)15-9/h3-4,9-10H,1-2,5-8H2 |
| InChIKey | QJNOZFPGWQBKCC-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|