C16H16O8S3 — CID 89314014
4,5-bis(benzenesulfonylmethyl)-1,3,2-dioxathiolane 2,2-dioxide (PubChem CID 89314014) has the molecular formula C16H16O8S3 and a molecular weight of 432.50 g/mol. Its IUPAC name is 4,5-bis(benzenesulfonylmethyl)-1,3,2-dioxathiolane 2,2-dioxide.
| Compound Name | 4,5-bis(benzenesulfonylmethyl)-1,3,2-dioxathiolane 2,2-dioxide |
|---|---|
| PubChem CID | 89314014 |
| Molecular Formula | C16H16O8S3 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | 4,5-bis(benzenesulfonylmethyl)-1,3,2-dioxathiolane 2,2-dioxide |
| SMILES | O=S1(=O)OC(CS(=O)(=O)c2ccccc2)C(CS(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C16H16O8S3/c17-25(18,13-7-3-1-4-8-13)11-15-16(24-27(21,22)23-15)12-26(19,20)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
| InChIKey | VXJZNLCOGABXCO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |