C10H16O7S3 — CID 89314061
4,5-bis(prop-2-enylsulfonylmethyl)-1,3,2-dioxathiolane 2-oxide (PubChem CID 89314061) has the molecular formula C10H16O7S3 and a molecular weight of 344.43 g/mol. Its IUPAC name is 4,5-bis(prop-2-enylsulfonylmethyl)-1,3,2-dioxathiolane 2-oxide.
| Compound Name | 4,5-bis(prop-2-enylsulfonylmethyl)-1,3,2-dioxathiolane 2-oxide |
|---|---|
| PubChem CID | 89314061 |
| Molecular Formula | C10H16O7S3 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 4,5-bis(prop-2-enylsulfonylmethyl)-1,3,2-dioxathiolane 2-oxide |
| SMILES | C=CCS(=O)(=O)CC1OS(=O)OC1CS(=O)(=O)CC=C |
| InChI | InChI=1S/C10H16O7S3/c1-3-5-19(12,13)7-9-10(17-18(11)16-9)8-20(14,15)6-4-2/h3-4,9-10H,1-2,5-8H2 |
| InChIKey | OCEHFZGFVGZGQR-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|