C13H17FIN3O2 — CID 89314996
trans-ethyl (1S,2S)-2-[[5-fluoro-2-(iodomethyl)pyrimidin-4-yl]amino]cyclopentane-1-carboxylate (PubChem CID 89314996) has the molecular formula C13H17FIN3O2 and a molecular weight of 393.20 g/mol. Its IUPAC name is trans-ethyl (1S,2S)-2-[[5-fluoro-2-(iodomethyl)pyrimidin-4-yl]amino]cyclopentane-1-carboxylate.
| Compound Name | trans-ethyl (1S,2S)-2-[[5-fluoro-2-(iodomethyl)pyrimidin-4-yl]amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 89314996 |
| Molecular Formula | C13H17FIN3O2 |
| Molecular Weight | 393.20 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | trans-ethyl (1S,2S)-2-[[5-fluoro-2-(iodomethyl)pyrimidin-4-yl]amino]cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[C@@H]1Nc1nc(CI)ncc1F |
| InChI | InChI=1S/C13H17FIN3O2/c1-2-20-13(19)8-4-3-5-10(8)17-12-9(14)7-16-11(6-15)18-12/h7-8,10H,2-6H2,1H3,(H,16,17,18)/t8-,10-/m0/s1 |
| InChIKey | KAIBOBSJCBDKGR-WPRPVWTQSA-N |
| XLogP | 2.69 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|