C13H18ClNO — CID 89315041
methyl N-[(3E,5E)-5-(1-chloroethenyl)nona-3,5,8-trien-4-yl]methanimidate (PubChem CID 89315041) has the molecular formula C13H18ClNO and a molecular weight of 239.75 g/mol. Its IUPAC name is methyl N-[(3E,5E)-5-(1-chloroethenyl)nona-3,5,8-trien-4-yl]methanimidate.
| Compound Name | methyl N-[(3E,5E)-5-(1-chloroethenyl)nona-3,5,8-trien-4-yl]methanimidate |
|---|---|
| PubChem CID | 89315041 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | methyl N-[(3E,5E)-5-(1-chloroethenyl)nona-3,5,8-trien-4-yl]methanimidate |
| SMILES | C=CC/C=C(/C(=C)Cl)C(=CCC)/N=C/OC |
| InChI | InChI=1S/C13H18ClNO/c1-5-7-9-12(11(3)14)13(8-6-2)15-10-16-4/h5,8-10H,1,3,6-7H2,2,4H3/b12-9-,13-8+,15-10+ |
| InChIKey | QHYKSFCGEFOLHI-MKBPICHISA-N |
| XLogP | 4.21 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|