About 4-methyloxetane-2,3-dicarboxylic acid
4-methyloxetane-2,3-dicarboxylic acid (PubChem CID 89315137) has the molecular formula C6H8O5
and a molecular weight of 160.12 g/mol. Its IUPAC name is 4-methyloxetane-2,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-methyloxetane-2,3-dicarboxylic acid |
| PubChem CID | 89315137 |
| Molecular Formula | C6H8O5 |
| Molecular Weight | 160.12 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | 4-methyloxetane-2,3-dicarboxylic acid |
| SMILES | CC1OC(C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C6H8O5/c1-2-3(5(7)8)4(11-2)6(9)10/h2-4H,1H3,(H,7,8)(H,9,10) |
| InChIKey | XYSGDTBOIWFKPD-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.12 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyloxetane-2,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyloxetane-2,3-dicarboxylic acid?
The IUPAC name of 4-methyloxetane-2,3-dicarboxylic acid (CID 89315137) is 4-methyloxetane-2,3-dicarboxylic acid.
What is the SMILES notation for 4-methyloxetane-2,3-dicarboxylic acid?
The canonical SMILES for 4-methyloxetane-2,3-dicarboxylic acid is CC1OC(C(=O)O)C1C(=O)O.
What is the InChIKey of 4-methyloxetane-2,3-dicarboxylic acid?
The InChIKey is XYSGDTBOIWFKPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O5/c1-2-3(5(7)8)4(11-2)6(9)10/h2-4H,1H3,(H,7,8)(H,9,10).
What are the key properties of 4-methyloxetane-2,3-dicarboxylic acid?
4-methyloxetane-2,3-dicarboxylic acid has a molecular weight of 160.12 g/mol, XLogP of -0.44, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyloxetane-2,3-dicarboxylic acid is sourced from PubChem (CID 89315137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).