C21H24N2O9S3 — CID 89315353
5-(cyclopropylsulfonylamino)-2-[(E)-2-[4-[(2-methyl-2-sulfopropanoyl)amino]phenyl]ethenyl]benzenesulfonic acid (PubChem CID 89315353) has the molecular formula C21H24N2O9S3 and a molecular weight of 544.63 g/mol. Its IUPAC name is 5-(cyclopropylsulfonylamino)-2-[(E)-2-[4-[(2-methyl-2-sulfopropanoyl)amino]phenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-(cyclopropylsulfonylamino)-2-[(E)-2-[4-[(2-methyl-2-sulfopropanoyl)amino]phenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 89315353 |
| Molecular Formula | C21H24N2O9S3 |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.06 |
| IUPAC Name | 5-(cyclopropylsulfonylamino)-2-[(E)-2-[4-[(2-methyl-2-sulfopropanoyl)amino]phenyl]ethenyl]benzenesulfonic acid |
| SMILES | CC(C)(C(=O)Nc1ccc(/C=C/c2ccc(NS(=O)(=O)C3CC3)cc2S(=O)(=O)O)cc1)S(=O)(=O)O |
| InChI | InChI=1S/C21H24N2O9S3/c1-21(2,35(30,31)32)20(24)22-16-8-4-14(5-9-16)3-6-15-7-10-17(13-19(15)34(27,28)29)23-33(25,26)18-11-12-18/h3-10,13,18,23H,11-12H2,1-2H3,(H,22,24)(H,27,28,29)(H,30,31,32)/b6-3+ |
| InChIKey | UICKSLKIWHRBNQ-ZZXKWVIFSA-N |
| XLogP | 2.61 |
| TPSA | 184.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|