About 1-methyl-5H-[1,2,4]triazolo[4,3-a]quinolin-4-one
1-methyl-5H-[1,2,4]triazolo[4,3-a]quinolin-4-one (PubChem CID 89315355) has the molecular formula C11H9N3O
and a molecular weight of 199.21 g/mol. Its IUPAC name is 1-methyl-5H-[1,2,4]triazolo[4,3-a]quinolin-4-one.
Molecular Properties
| Compound Name | 1-methyl-5H-[1,2,4]triazolo[4,3-a]quinolin-4-one |
| PubChem CID | 89315355 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 1-methyl-5H-[1,2,4]triazolo[4,3-a]quinolin-4-one |
| SMILES | Cc1nnc2n1-c1ccccc1CC2=O |
| InChI | InChI=1S/C11H9N3O/c1-7-12-13-11-10(15)6-8-4-2-3-5-9(8)14(7)11/h2-5H,6H2,1H3 |
| InChIKey | GGHXUCNTZVMTHX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-5H-[1,2,4]triazolo[4,3-a]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5H-[1,2,4]triazolo[4,3-a]quinolin-4-one?
The IUPAC name of 1-methyl-5H-[1,2,4]triazolo[4,3-a]quinolin-4-one (CID 89315355) is 1-methyl-5H-[1,2,4]triazolo[4,3-a]quinolin-4-one.
What is the SMILES notation for 1-methyl-5H-[1,2,4]triazolo[4,3-a]quinolin-4-one?
The canonical SMILES for 1-methyl-5H-[1,2,4]triazolo[4,3-a]quinolin-4-one is Cc1nnc2n1-c1ccccc1CC2=O.
What is the InChIKey of 1-methyl-5H-[1,2,4]triazolo[4,3-a]quinolin-4-one?
The InChIKey is GGHXUCNTZVMTHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O/c1-7-12-13-11-10(15)6-8-4-2-3-5-9(8)14(7)11/h2-5H,6H2,1H3.
What are the key properties of 1-methyl-5H-[1,2,4]triazolo[4,3-a]quinolin-4-one?
1-methyl-5H-[1,2,4]triazolo[4,3-a]quinolin-4-one has a molecular weight of 199.21 g/mol, XLogP of 1.31, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5H-[1,2,4]triazolo[4,3-a]quinolin-4-one is sourced from PubChem (CID 89315355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).