C19H25F5N2O2 — CID 89315620
2-[[2,2-difluoro-2-[3-(4,4,4-trifluorobutoxy)phenyl]ethyl]amino]-2-piperidin-1-ylacetaldehyde (PubChem CID 89315620) has the molecular formula C19H25F5N2O2 and a molecular weight of 408.41 g/mol. Its IUPAC name is 2-[[2,2-difluoro-2-[3-(4,4,4-trifluorobutoxy)phenyl]ethyl]amino]-2-piperidin-1-ylacetaldehyde.
| Compound Name | 2-[[2,2-difluoro-2-[3-(4,4,4-trifluorobutoxy)phenyl]ethyl]amino]-2-piperidin-1-ylacetaldehyde |
|---|---|
| PubChem CID | 89315620 |
| Molecular Formula | C19H25F5N2O2 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-[[2,2-difluoro-2-[3-(4,4,4-trifluorobutoxy)phenyl]ethyl]amino]-2-piperidin-1-ylacetaldehyde |
| SMILES | O=CC(NCC(F)(F)c1cccc(OCCCC(F)(F)F)c1)N1CCCCC1 |
| InChI | InChI=1S/C19H25F5N2O2/c20-18(21,14-25-17(13-27)26-9-2-1-3-10-26)15-6-4-7-16(12-15)28-11-5-8-19(22,23)24/h4,6-7,12-13,17,25H,1-3,5,8-11,14H2 |
| InChIKey | OSHDSJNKPAIZPM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|