C18H39NO2 — CID 89315775
[(6S,7R)-7-amino-5,6-diethyl-3,4,4,5,6-pentamethyloctoxy]methanol (PubChem CID 89315775) has the molecular formula C18H39NO2 and a molecular weight of 301.52 g/mol. Its IUPAC name is [(6S,7R)-7-amino-5,6-diethyl-3,4,4,5,6-pentamethyloctoxy]methanol.
| Compound Name | [(6S,7R)-7-amino-5,6-diethyl-3,4,4,5,6-pentamethyloctoxy]methanol |
|---|---|
| PubChem CID | 89315775 |
| Molecular Formula | C18H39NO2 |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.30 |
| IUPAC Name | [(6S,7R)-7-amino-5,6-diethyl-3,4,4,5,6-pentamethyloctoxy]methanol |
| SMILES | CCC(C)(C(C)(C)C(C)CCOCO)[C@](C)(CC)[C@@H](C)N |
| InChI | InChI=1S/C18H39NO2/c1-9-17(7,15(4)19)18(8,10-2)16(5,6)14(3)11-12-21-13-20/h14-15,20H,9-13,19H2,1-8H3/t14?,15-,17-,18?/m1/s1 |
| InChIKey | NFTGMUOGPZDILI-CQDXFGNVSA-N |
| XLogP | 4.18 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|