About (3,4-diiminocyclohexa-1,5-dien-1-yl)methanethiol
(3,4-diiminocyclohexa-1,5-dien-1-yl)methanethiol (PubChem CID 89316288) has the molecular formula C7H8N2S
and a molecular weight of 152.22 g/mol. Its IUPAC name is (3,4-diiminocyclohexa-1,5-dien-1-yl)methanethiol.
Molecular Properties
| Compound Name | (3,4-diiminocyclohexa-1,5-dien-1-yl)methanethiol |
| PubChem CID | 89316288 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | (3,4-diiminocyclohexa-1,5-dien-1-yl)methanethiol |
| SMILES | [H]/N=C1\C=CC(CS)=C\C1=N/[H] |
| InChI | InChI=1S/C7H8N2S/c8-6-2-1-5(4-10)3-7(6)9/h1-3,8-10H,4H2/b8-6+,9-7+ |
| InChIKey | BBCIZOQKKKBKGV-CDJQDVQCSA-N |
| XLogP | 1.45 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3,4-diiminocyclohexa-1,5-dien-1-yl)methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-diiminocyclohexa-1,5-dien-1-yl)methanethiol?
The IUPAC name of (3,4-diiminocyclohexa-1,5-dien-1-yl)methanethiol (CID 89316288) is (3,4-diiminocyclohexa-1,5-dien-1-yl)methanethiol.
What is the SMILES notation for (3,4-diiminocyclohexa-1,5-dien-1-yl)methanethiol?
The canonical SMILES for (3,4-diiminocyclohexa-1,5-dien-1-yl)methanethiol is [H]/N=C1\C=CC(CS)=C\C1=N/[H].
What is the InChIKey of (3,4-diiminocyclohexa-1,5-dien-1-yl)methanethiol?
The InChIKey is BBCIZOQKKKBKGV-CDJQDVQCSA-N. The full InChI is InChI=1S/C7H8N2S/c8-6-2-1-5(4-10)3-7(6)9/h1-3,8-10H,4H2/b8-6+,9-7+.
What are the key properties of (3,4-diiminocyclohexa-1,5-dien-1-yl)methanethiol?
(3,4-diiminocyclohexa-1,5-dien-1-yl)methanethiol has a molecular weight of 152.22 g/mol, XLogP of 1.45, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-diiminocyclohexa-1,5-dien-1-yl)methanethiol is sourced from PubChem (CID 89316288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).