About 3-[1-[[6-(2-methylbutoxy)-1-benzofuran-2-yl]methylamino]ethenyl]pyridine-2,6-diamine
3-[1-[[6-(2-methylbutoxy)-1-benzofuran-2-yl]methylamino]ethenyl]pyridine-2,6-diamine (PubChem CID 89316306) has the molecular formula C21H26N4O2
and a molecular weight of 366.47 g/mol. Its IUPAC name is 3-[1-[[6-(2-methylbutoxy)-1-benzofuran-2-yl]methylamino]ethenyl]pyridine-2,6-diamine.
Molecular Properties
| Compound Name | 3-[1-[[6-(2-methylbutoxy)-1-benzofuran-2-yl]methylamino]ethenyl]pyridine-2,6-diamine |
| PubChem CID | 89316306 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 3-[1-[[6-(2-methylbutoxy)-1-benzofuran-2-yl]methylamino]ethenyl]pyridine-2,6-diamine |
| SMILES | C=C(NCc1cc2ccc(OCC(C)CC)cc2o1)c1ccc(N)nc1N |
| InChI | InChI=1S/C21H26N4O2/c1-4-13(2)12-26-16-6-5-15-9-17(27-19(15)10-16)11-24-14(3)18-7-8-20(22)25-21(18)23/h5-10,13,24H,3-4,11-12H2,1-2H3,(H4,22,23,25) |
| InChIKey | HEBYRRWNHWVBJY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[1-[[6-(2-methylbutoxy)-1-benzofuran-2-yl]methylamino]ethenyl]pyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[[6-(2-methylbutoxy)-1-benzofuran-2-yl]methylamino]ethenyl]pyridine-2,6-diamine?
The IUPAC name of 3-[1-[[6-(2-methylbutoxy)-1-benzofuran-2-yl]methylamino]ethenyl]pyridine-2,6-diamine (CID 89316306) is 3-[1-[[6-(2-methylbutoxy)-1-benzofuran-2-yl]methylamino]ethenyl]pyridine-2,6-diamine.
What is the SMILES notation for 3-[1-[[6-(2-methylbutoxy)-1-benzofuran-2-yl]methylamino]ethenyl]pyridine-2,6-diamine?
The canonical SMILES for 3-[1-[[6-(2-methylbutoxy)-1-benzofuran-2-yl]methylamino]ethenyl]pyridine-2,6-diamine is C=C(NCc1cc2ccc(OCC(C)CC)cc2o1)c1ccc(N)nc1N.
What is the InChIKey of 3-[1-[[6-(2-methylbutoxy)-1-benzofuran-2-yl]methylamino]ethenyl]pyridine-2,6-diamine?
The InChIKey is HEBYRRWNHWVBJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O2/c1-4-13(2)12-26-16-6-5-15-9-17(27-19(15)10-16)11-24-14(3)18-7-8-20(22)25-21(18)23/h5-10,13,24H,3-4,11-12H2,1-2H3,(H4,22,23,25).
What are the key properties of 3-[1-[[6-(2-methylbutoxy)-1-benzofuran-2-yl]methylamino]ethenyl]pyridine-2,6-diamine?
3-[1-[[6-(2-methylbutoxy)-1-benzofuran-2-yl]methylamino]ethenyl]pyridine-2,6-diamine has a molecular weight of 366.47 g/mol, XLogP of 4.18, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[[6-(2-methylbutoxy)-1-benzofuran-2-yl]methylamino]ethenyl]pyridine-2,6-diamine is sourced from PubChem (CID 89316306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).