About CID 89317244
CID 89317244 (PubChem CID 89317244) has the molecular formula C34H18BBr3S4
and a molecular weight of 805.31 g/mol.
Molecular Properties
| Compound Name | CID 89317244 |
| PubChem CID | 89317244 |
| Molecular Formula | C34H18BBr3S4 |
| Molecular Weight | 805.31 g/mol |
| Exact Mass | 801.79 |
| IUPAC Name | — |
| SMILES | [B]c1cc(-c2cc(-c3cccs3)c(-c3cccs3)cc2Br)c(Br)cc1-c1cc(-c2cccs2)c(-c2cccs2)cc1Br |
| InChI | InChI=1S/C34H18BBr3S4/c35-27-15-22(21-14-24(32-6-2-10-40-32)26(18-30(21)38)34-8-4-12-42-34)28(36)16-19(27)20-13-23(31-5-1-9-39-31)25(17-29(20)37)33-7-3-11-41-33/h1-18H |
| InChIKey | ZEYKNKIIZFGPKB-UHFFFAOYSA-N |
| XLogP | 13.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 805.31 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89317244 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89317244?
The IUPAC name of CID 89317244 (CID 89317244) is not available.
What is the SMILES notation for CID 89317244?
The canonical SMILES for CID 89317244 is [B]c1cc(-c2cc(-c3cccs3)c(-c3cccs3)cc2Br)c(Br)cc1-c1cc(-c2cccs2)c(-c2cccs2)cc1Br.
What is the InChIKey of CID 89317244?
The InChIKey is ZEYKNKIIZFGPKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H18BBr3S4/c35-27-15-22(21-14-24(32-6-2-10-40-32)26(18-30(21)38)34-8-4-12-42-34)28(36)16-19(27)20-13-23(31-5-1-9-39-31)25(17-29(20)37)33-7-3-11-41-33/h1-18H.
What are the key properties of CID 89317244?
CID 89317244 has a molecular weight of 805.31 g/mol, XLogP of 13.02, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89317244 is sourced from PubChem (CID 89317244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).