About CID 89317260
CID 89317260 (PubChem CID 89317260) has the molecular formula C42H26BBr3
and a molecular weight of 781.19 g/mol.
Molecular Properties
| Compound Name | CID 89317260 |
| PubChem CID | 89317260 |
| Molecular Formula | C42H26BBr3 |
| Molecular Weight | 781.19 g/mol |
| Exact Mass | 777.97 |
| IUPAC Name | — |
| SMILES | [B]c1cc(-c2ccccc2)c(-c2ccccc2)cc1-c1cc(Br)c(-c2cc(-c3ccccc3)c(-c3ccccc3)cc2Br)cc1Br |
| InChI | InChI=1S/C42H26BBr3/c43-39-23-33(29-17-9-3-10-18-29)31(27-13-5-1-6-14-27)21-35(39)37-25-42(46)38(26-41(37)45)36-22-32(28-15-7-2-8-16-28)34(24-40(36)44)30-19-11-4-12-20-30/h1-26H |
| InChIKey | CLDOSBVQGWGJFL-UHFFFAOYSA-N |
| XLogP | 12.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 781.19 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89317260 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89317260?
The IUPAC name of CID 89317260 (CID 89317260) is not available.
What is the SMILES notation for CID 89317260?
The canonical SMILES for CID 89317260 is [B]c1cc(-c2ccccc2)c(-c2ccccc2)cc1-c1cc(Br)c(-c2cc(-c3ccccc3)c(-c3ccccc3)cc2Br)cc1Br.
What is the InChIKey of CID 89317260?
The InChIKey is CLDOSBVQGWGJFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H26BBr3/c43-39-23-33(29-17-9-3-10-18-29)31(27-13-5-1-6-14-27)21-35(39)37-25-42(46)38(26-41(37)45)36-22-32(28-15-7-2-8-16-28)34(24-40(36)44)30-19-11-4-12-20-30/h1-26H.
What are the key properties of CID 89317260?
CID 89317260 has a molecular weight of 781.19 g/mol, XLogP of 12.77, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89317260 is sourced from PubChem (CID 89317260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).