C13H15N — CID 89317268
3,4,4a,4b,8a,9a-hexahydrofluoren-9-imine (PubChem CID 89317268) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 3,4,4a,4b,8a,9a-hexahydrofluoren-9-imine.
| Compound Name | 3,4,4a,4b,8a,9a-hexahydrofluoren-9-imine |
|---|---|
| PubChem CID | 89317268 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 3,4,4a,4b,8a,9a-hexahydrofluoren-9-imine |
| SMILES | [H]/N=C1/C2C=CC=CC2C2CCC=CC12 |
| InChI | InChI=1S/C13H15N/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1,3-5,7-12,14H,2,6H2/b14-13- |
| InChIKey | XOIRPYBCQLQRDU-YPKPFQOOSA-N |
| XLogP | 2.96 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|