C38H59N2O3+ — CID 89317320
[(1R,4R,5R,10S,13R,19R)-4,5,9,9,13,20,20-heptamethyl-23-oxahexacyclo[17.3.1.01,18.04,17.05,14.08,13]tricosan-10-yl] 2-[4-(dimethylamino)pyridin-1-ium-1-yl]acetate (PubChem CID 89317320) has the molecular formula C38H59N2O3+ and a molecular weight of 591.90 g/mol. Its IUPAC name is [(1R,4R,5R,10S,13R,19R)-4,5,9,9,13,20,20-heptamethyl-23-oxahexacyclo[17.3.1.01,18.04,17.05,14.08,13]tricosan-10-yl] 2-[4-(dimethylamino)pyridin-1-ium-1-yl]acetate.
| Compound Name | [(1R,4R,5R,10S,13R,19R)-4,5,9,9,13,20,20-heptamethyl-23-oxahexacyclo[17.3.1.01,18.04,17.05,14.08,13]tricosan-10-yl] 2-[4-(dimethylamino)pyridin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 89317320 |
| Molecular Formula | C38H59N2O3+ |
| Molecular Weight | 591.90 g/mol |
| Exact Mass | 591.45 |
| IUPAC Name | [(1R,4R,5R,10S,13R,19R)-4,5,9,9,13,20,20-heptamethyl-23-oxahexacyclo[17.3.1.01,18.04,17.05,14.08,13]tricosan-10-yl] 2-[4-(dimethylamino)pyridin-1-ium-1-yl]acetate |
| SMILES | CN(C)c1cc[n+](CC(=O)O[C@H]2CC[C@@]3(C)C(CC[C@]4(C)C3CCC3C5[C@H]6O[C@@]5(CCC6(C)C)CC[C@]34C)C2(C)C)cc1 |
| InChI | InChI=1S/C38H59N2O3/c1-33(2)18-20-38-21-19-36(6)26(31(38)32(33)43-38)10-11-28-35(5)16-13-29(34(3,4)27(35)12-17-37(28,36)7)42-30(41)24-40-22-14-25(15-23-40)39(8)9/h14-15,22-23,26-29,31-32H,10-13,16-21,24H2,1-9H3/q+1/t26?,27?,28?,29-,31?,32+,35-,36+,37+,38-/m0/s1 |
| InChIKey | QKEFEZQHHBKKPQ-JUPLPBTRSA-N |
| XLogP | 7.59 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.90 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|