C15H23F4NO — CID 89317351
2-(ethylamino)-1-(1,1,2,2-tetrafluorospiro[2.5]octan-6-yl)pentan-3-one (PubChem CID 89317351) has the molecular formula C15H23F4NO and a molecular weight of 309.35 g/mol. Its IUPAC name is 2-(ethylamino)-1-(1,1,2,2-tetrafluorospiro[2.5]octan-6-yl)pentan-3-one.
| Compound Name | 2-(ethylamino)-1-(1,1,2,2-tetrafluorospiro[2.5]octan-6-yl)pentan-3-one |
|---|---|
| PubChem CID | 89317351 |
| Molecular Formula | C15H23F4NO |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-(ethylamino)-1-(1,1,2,2-tetrafluorospiro[2.5]octan-6-yl)pentan-3-one |
| SMILES | CCNC(CC1CCC2(CC1)C(F)(F)C2(F)F)C(=O)CC |
| InChI | InChI=1S/C15H23F4NO/c1-3-12(21)11(20-4-2)9-10-5-7-13(8-6-10)14(16,17)15(13,18)19/h10-11,20H,3-9H2,1-2H3 |
| InChIKey | ZFKKTYNCKRGRNJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|