C7H9I7 — CID 89317363
1,2,3,4,5,6,7-heptaiodoheptane (PubChem CID 89317363) has the molecular formula C7H9I7 and a molecular weight of 981.48 g/mol. Its IUPAC name is 1,2,3,4,5,6,7-heptaiodoheptane.
| Compound Name | 1,2,3,4,5,6,7-heptaiodoheptane |
|---|---|
| PubChem CID | 89317363 |
| Molecular Formula | C7H9I7 |
| Molecular Weight | 981.48 g/mol |
| Exact Mass | 981.40 |
| IUPAC Name | 1,2,3,4,5,6,7-heptaiodoheptane |
| SMILES | ICC(I)C(I)C(I)C(I)C(I)CI |
| InChI | InChI=1S/C7H9I7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3-7H,1-2H2 |
| InChIKey | IHRQPKNVOMHWGA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.48 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|