C19H11Cl3O4 — CID 89317506
(9,10-dioxo-2-prop-2-enylanthracen-1-yl) 2,2,2-trichloroacetate (PubChem CID 89317506) has the molecular formula C19H11Cl3O4 and a molecular weight of 409.65 g/mol. Its IUPAC name is (9,10-dioxo-2-prop-2-enylanthracen-1-yl) 2,2,2-trichloroacetate.
| Compound Name | (9,10-dioxo-2-prop-2-enylanthracen-1-yl) 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 89317506 |
| Molecular Formula | C19H11Cl3O4 |
| Molecular Weight | 409.65 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | (9,10-dioxo-2-prop-2-enylanthracen-1-yl) 2,2,2-trichloroacetate |
| SMILES | C=CCc1ccc2c(c1OC(=O)C(Cl)(Cl)Cl)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H11Cl3O4/c1-2-5-10-8-9-13-14(17(10)26-18(25)19(20,21)22)16(24)12-7-4-3-6-11(12)15(13)23/h2-4,6-9H,1,5H2 |
| InChIKey | YHMIHSYHHOLGPA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.65 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|