About methyl (2S)-3-(3,5-difluorophenyl)-2-(methylideneboranyldiazenyl)propanoate
methyl (2S)-3-(3,5-difluorophenyl)-2-(methylideneboranyldiazenyl)propanoate (PubChem CID 89317517) has the molecular formula C11H11BF2N2O2
and a molecular weight of 252.03 g/mol. Its IUPAC name is methyl (2S)-3-(3,5-difluorophenyl)-2-(methylideneboranyldiazenyl)propanoate.
Molecular Properties
| Compound Name | methyl (2S)-3-(3,5-difluorophenyl)-2-(methylideneboranyldiazenyl)propanoate |
| PubChem CID | 89317517 |
| Molecular Formula | C11H11BF2N2O2 |
| Molecular Weight | 252.03 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | methyl (2S)-3-(3,5-difluorophenyl)-2-(methylideneboranyldiazenyl)propanoate |
| SMILES | C=B/N=N/[C@@H](Cc1cc(F)cc(F)c1)C(=O)OC |
| InChI | InChI=1S/C11H11BF2N2O2/c1-12-16-15-10(11(17)18-2)5-7-3-8(13)6-9(14)4-7/h3-4,6,10H,1,5H2,2H3/b16-15+/t10-/m0/s1 |
| InChIKey | CVKWMHKVQLEOBL-OGNJIVFWSA-N |
| XLogP | 1.55 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.03 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-3-(3,5-difluorophenyl)-2-(methylideneboranyldiazenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-3-(3,5-difluorophenyl)-2-(methylideneboranyldiazenyl)propanoate?
The IUPAC name of methyl (2S)-3-(3,5-difluorophenyl)-2-(methylideneboranyldiazenyl)propanoate (CID 89317517) is methyl (2S)-3-(3,5-difluorophenyl)-2-(methylideneboranyldiazenyl)propanoate.
What is the SMILES notation for methyl (2S)-3-(3,5-difluorophenyl)-2-(methylideneboranyldiazenyl)propanoate?
The canonical SMILES for methyl (2S)-3-(3,5-difluorophenyl)-2-(methylideneboranyldiazenyl)propanoate is C=B/N=N/[C@@H](Cc1cc(F)cc(F)c1)C(=O)OC.
What is the InChIKey of methyl (2S)-3-(3,5-difluorophenyl)-2-(methylideneboranyldiazenyl)propanoate?
The InChIKey is CVKWMHKVQLEOBL-OGNJIVFWSA-N. The full InChI is InChI=1S/C11H11BF2N2O2/c1-12-16-15-10(11(17)18-2)5-7-3-8(13)6-9(14)4-7/h3-4,6,10H,1,5H2,2H3/b16-15+/t10-/m0/s1.
What are the key properties of methyl (2S)-3-(3,5-difluorophenyl)-2-(methylideneboranyldiazenyl)propanoate?
methyl (2S)-3-(3,5-difluorophenyl)-2-(methylideneboranyldiazenyl)propanoate has a molecular weight of 252.03 g/mol, XLogP of 1.55, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-3-(3,5-difluorophenyl)-2-(methylideneboranyldiazenyl)propanoate is sourced from PubChem (CID 89317517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).