About 2,5-dimethoxy-3,6-dimethyl-N-propan-2-yl-4-[4-(propan-2-ylamino)phenyl]benzamide
2,5-dimethoxy-3,6-dimethyl-N-propan-2-yl-4-[4-(propan-2-ylamino)phenyl]benzamide (PubChem CID 89317618) has the molecular formula C23H32N2O3
and a molecular weight of 384.52 g/mol. Its IUPAC name is 2,5-dimethoxy-3,6-dimethyl-N-propan-2-yl-4-[4-(propan-2-ylamino)phenyl]benzamide.
Molecular Properties
| Compound Name | 2,5-dimethoxy-3,6-dimethyl-N-propan-2-yl-4-[4-(propan-2-ylamino)phenyl]benzamide |
| PubChem CID | 89317618 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 2,5-dimethoxy-3,6-dimethyl-N-propan-2-yl-4-[4-(propan-2-ylamino)phenyl]benzamide |
| SMILES | COc1c(C)c(-c2ccc(NC(C)C)cc2)c(OC)c(C)c1C(=O)NC(C)C |
| InChI | InChI=1S/C23H32N2O3/c1-13(2)24-18-11-9-17(10-12-18)19-15(5)22(28-8)20(16(6)21(19)27-7)23(26)25-14(3)4/h9-14,24H,1-8H3,(H,25,26) |
| InChIKey | VNUJJYVFGPVMSX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-dimethoxy-3,6-dimethyl-N-propan-2-yl-4-[4-(propan-2-ylamino)phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethoxy-3,6-dimethyl-N-propan-2-yl-4-[4-(propan-2-ylamino)phenyl]benzamide?
The IUPAC name of 2,5-dimethoxy-3,6-dimethyl-N-propan-2-yl-4-[4-(propan-2-ylamino)phenyl]benzamide (CID 89317618) is 2,5-dimethoxy-3,6-dimethyl-N-propan-2-yl-4-[4-(propan-2-ylamino)phenyl]benzamide.
What is the SMILES notation for 2,5-dimethoxy-3,6-dimethyl-N-propan-2-yl-4-[4-(propan-2-ylamino)phenyl]benzamide?
The canonical SMILES for 2,5-dimethoxy-3,6-dimethyl-N-propan-2-yl-4-[4-(propan-2-ylamino)phenyl]benzamide is COc1c(C)c(-c2ccc(NC(C)C)cc2)c(OC)c(C)c1C(=O)NC(C)C.
What is the InChIKey of 2,5-dimethoxy-3,6-dimethyl-N-propan-2-yl-4-[4-(propan-2-ylamino)phenyl]benzamide?
The InChIKey is VNUJJYVFGPVMSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32N2O3/c1-13(2)24-18-11-9-17(10-12-18)19-15(5)22(28-8)20(16(6)21(19)27-7)23(26)25-14(3)4/h9-14,24H,1-8H3,(H,25,26).
What are the key properties of 2,5-dimethoxy-3,6-dimethyl-N-propan-2-yl-4-[4-(propan-2-ylamino)phenyl]benzamide?
2,5-dimethoxy-3,6-dimethyl-N-propan-2-yl-4-[4-(propan-2-ylamino)phenyl]benzamide has a molecular weight of 384.52 g/mol, XLogP of 4.95, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethoxy-3,6-dimethyl-N-propan-2-yl-4-[4-(propan-2-ylamino)phenyl]benzamide is sourced from PubChem (CID 89317618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).