C27H26FN3O3 — CID 89317749
N-[2-(4-ethyl-2,3-dihydro-1,4-benzoxazin-7-yl)propan-2-yl]-2-fluoro-9-oxo-10H-acridine-3-carboxamide (PubChem CID 89317749) has the molecular formula C27H26FN3O3 and a molecular weight of 459.52 g/mol. Its IUPAC name is N-[2-(4-ethyl-2,3-dihydro-1,4-benzoxazin-7-yl)propan-2-yl]-2-fluoro-9-oxo-10H-acridine-3-carboxamide.
| Compound Name | N-[2-(4-ethyl-2,3-dihydro-1,4-benzoxazin-7-yl)propan-2-yl]-2-fluoro-9-oxo-10H-acridine-3-carboxamide |
|---|---|
| PubChem CID | 89317749 |
| Molecular Formula | C27H26FN3O3 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | N-[2-(4-ethyl-2,3-dihydro-1,4-benzoxazin-7-yl)propan-2-yl]-2-fluoro-9-oxo-10H-acridine-3-carboxamide |
| SMILES | CCN1CCOc2cc(C(C)(C)NC(=O)c3cc4[nH]c5ccccc5c(=O)c4cc3F)ccc21 |
| InChI | InChI=1S/C27H26FN3O3/c1-4-31-11-12-34-24-13-16(9-10-23(24)31)27(2,3)30-26(33)18-15-22-19(14-20(18)28)25(32)17-7-5-6-8-21(17)29-22/h5-10,13-15H,4,11-12H2,1-3H3,(H,29,32)(H,30,33) |
| InChIKey | QMEONQMYRCGTLS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|