C10H16OS — CID 89317789
3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]thiepine-7-carbaldehyde (PubChem CID 89317789) has the molecular formula C10H16OS and a molecular weight of 184.30 g/mol. Its IUPAC name is 3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]thiepine-7-carbaldehyde.
| Compound Name | 3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]thiepine-7-carbaldehyde |
|---|---|
| PubChem CID | 89317789 |
| Molecular Formula | C10H16OS |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]thiepine-7-carbaldehyde |
| SMILES | O=CC1CC2CCCCSC2C1 |
| InChI | InChI=1S/C10H16OS/c11-7-8-5-9-3-1-2-4-12-10(9)6-8/h7-10H,1-6H2 |
| InChIKey | WNJFQRVRIDMJCY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|