About 5-[amino(propan-2-yl)amino]-N-propan-2-ylocta-1,7-dien-4-amine
5-[amino(propan-2-yl)amino]-N-propan-2-ylocta-1,7-dien-4-amine (PubChem CID 89317804) has the molecular formula C14H29N3
and a molecular weight of 239.41 g/mol. Its IUPAC name is 5-[amino(propan-2-yl)amino]-N-propan-2-ylocta-1,7-dien-4-amine.
Molecular Properties
| Compound Name | 5-[amino(propan-2-yl)amino]-N-propan-2-ylocta-1,7-dien-4-amine |
| PubChem CID | 89317804 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | 5-[amino(propan-2-yl)amino]-N-propan-2-ylocta-1,7-dien-4-amine |
| SMILES | C=CCC(NC(C)C)C(CC=C)N(N)C(C)C |
| InChI | InChI=1S/C14H29N3/c1-7-9-13(16-11(3)4)14(10-8-2)17(15)12(5)6/h7-8,11-14,16H,1-2,9-10,15H2,3-6H3 |
| InChIKey | BGLVCUKGBJDBJF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[amino(propan-2-yl)amino]-N-propan-2-ylocta-1,7-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[amino(propan-2-yl)amino]-N-propan-2-ylocta-1,7-dien-4-amine?
The IUPAC name of 5-[amino(propan-2-yl)amino]-N-propan-2-ylocta-1,7-dien-4-amine (CID 89317804) is 5-[amino(propan-2-yl)amino]-N-propan-2-ylocta-1,7-dien-4-amine.
What is the SMILES notation for 5-[amino(propan-2-yl)amino]-N-propan-2-ylocta-1,7-dien-4-amine?
The canonical SMILES for 5-[amino(propan-2-yl)amino]-N-propan-2-ylocta-1,7-dien-4-amine is C=CCC(NC(C)C)C(CC=C)N(N)C(C)C.
What is the InChIKey of 5-[amino(propan-2-yl)amino]-N-propan-2-ylocta-1,7-dien-4-amine?
The InChIKey is BGLVCUKGBJDBJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N3/c1-7-9-13(16-11(3)4)14(10-8-2)17(15)12(5)6/h7-8,11-14,16H,1-2,9-10,15H2,3-6H3.
What are the key properties of 5-[amino(propan-2-yl)amino]-N-propan-2-ylocta-1,7-dien-4-amine?
5-[amino(propan-2-yl)amino]-N-propan-2-ylocta-1,7-dien-4-amine has a molecular weight of 239.41 g/mol, XLogP of 2.46, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[amino(propan-2-yl)amino]-N-propan-2-ylocta-1,7-dien-4-amine is sourced from PubChem (CID 89317804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).