C16H32N2 — CID 89317806
4-N,5-N-ditert-butylocta-1,7-diene-4,5-diamine (PubChem CID 89317806) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 4-N,5-N-ditert-butylocta-1,7-diene-4,5-diamine.
| Compound Name | 4-N,5-N-ditert-butylocta-1,7-diene-4,5-diamine |
|---|---|
| PubChem CID | 89317806 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 4-N,5-N-ditert-butylocta-1,7-diene-4,5-diamine |
| SMILES | C=CCC(NC(C)(C)C)C(CC=C)NC(C)(C)C |
| InChI | InChI=1S/C16H32N2/c1-9-11-13(17-15(3,4)5)14(12-10-2)18-16(6,7)8/h9-10,13-14,17-18H,1-2,11-12H2,3-8H3 |
| InChIKey | YLKFSHWQXZBLOQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|