C17H25N — CID 89317828
(3Z,7Z,11Z)-N-buta-1,3-dien-2-yltrideca-3,7,11-trien-1-imine (PubChem CID 89317828) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is (3Z,7Z,11Z)-N-buta-1,3-dien-2-yltrideca-3,7,11-trien-1-imine.
| Compound Name | (3Z,7Z,11Z)-N-buta-1,3-dien-2-yltrideca-3,7,11-trien-1-imine |
|---|---|
| PubChem CID | 89317828 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | (3Z,7Z,11Z)-N-buta-1,3-dien-2-yltrideca-3,7,11-trien-1-imine |
| SMILES | C=CC(=C)/N=C/C/C=C\CC/C=C\CC/C=C\C |
| InChI | InChI=1S/C17H25N/c1-4-6-7-8-9-10-11-12-13-14-15-16-18-17(3)5-2/h4-6,9-10,13-14,16H,2-3,7-8,11-12,15H2,1H3/b6-4-,10-9-,14-13-,18-16+ |
| InChIKey | JXXQKTMGYIOPSK-JHIKPHMCSA-N |
| XLogP | 5.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|