C18H21NO4 — CID 89317955
prop-2-enyl 1-benzoyl-3-ethyl-2-oxopiperidine-3-carboxylate (PubChem CID 89317955) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is prop-2-enyl 1-benzoyl-3-ethyl-2-oxopiperidine-3-carboxylate.
| Compound Name | prop-2-enyl 1-benzoyl-3-ethyl-2-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 89317955 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | prop-2-enyl 1-benzoyl-3-ethyl-2-oxopiperidine-3-carboxylate |
| SMILES | C=CCOC(=O)C1(CC)CCCN(C(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C18H21NO4/c1-3-13-23-17(22)18(4-2)11-8-12-19(16(18)21)15(20)14-9-6-5-7-10-14/h3,5-7,9-10H,1,4,8,11-13H2,2H3 |
| InChIKey | CVVGOWUICMBHNL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|