C10H20N2 — CID 89317989
3-N,4-N-diethylhexa-1,5-diene-3,4-diamine (PubChem CID 89317989) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 3-N,4-N-diethylhexa-1,5-diene-3,4-diamine.
| Compound Name | 3-N,4-N-diethylhexa-1,5-diene-3,4-diamine |
|---|---|
| PubChem CID | 89317989 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 3-N,4-N-diethylhexa-1,5-diene-3,4-diamine |
| SMILES | C=CC(NCC)C(C=C)NCC |
| InChI | InChI=1S/C10H20N2/c1-5-9(11-7-3)10(6-2)12-8-4/h5-6,9-12H,1-2,7-8H2,3-4H3 |
| InChIKey | JLTFMMSSPRZBMX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|