About N-methyl-N'-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine
N-methyl-N'-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine (PubChem CID 89317993) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is N-methyl-N'-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-methyl-N'-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine |
| PubChem CID | 89317993 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | N-methyl-N'-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine |
| SMILES | C=C(C)/C=C(\C)NCCNC |
| InChI | InChI=1S/C9H18N2/c1-8(2)7-9(3)11-6-5-10-4/h7,10-11H,1,5-6H2,2-4H3/b9-7+ |
| InChIKey | FFEYEXOAAASOBR-VQHVLOKHSA-N |
| XLogP | 1.28 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N'-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine?
The IUPAC name of N-methyl-N'-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine (CID 89317993) is N-methyl-N'-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine.
What is the SMILES notation for N-methyl-N'-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine?
The canonical SMILES for N-methyl-N'-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine is C=C(C)/C=C(\C)NCCNC.
What is the InChIKey of N-methyl-N'-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine?
The InChIKey is FFEYEXOAAASOBR-VQHVLOKHSA-N. The full InChI is InChI=1S/C9H18N2/c1-8(2)7-9(3)11-6-5-10-4/h7,10-11H,1,5-6H2,2-4H3/b9-7+.
What are the key properties of N-methyl-N'-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine?
N-methyl-N'-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine has a molecular weight of 154.26 g/mol, XLogP of 1.28, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine is sourced from PubChem (CID 89317993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).