C14H28N2 — CID 89317994
4-N,5-N-di(propan-2-yl)octa-1,7-diene-4,5-diamine (PubChem CID 89317994) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 4-N,5-N-di(propan-2-yl)octa-1,7-diene-4,5-diamine.
| Compound Name | 4-N,5-N-di(propan-2-yl)octa-1,7-diene-4,5-diamine |
|---|---|
| PubChem CID | 89317994 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 4-N,5-N-di(propan-2-yl)octa-1,7-diene-4,5-diamine |
| SMILES | C=CCC(NC(C)C)C(CC=C)NC(C)C |
| InChI | InChI=1S/C14H28N2/c1-7-9-13(15-11(3)4)14(10-8-2)16-12(5)6/h7-8,11-16H,1-2,9-10H2,3-6H3 |
| InChIKey | PEBKFKHABWCIGR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|