C30H60ClN5 — CID 89318030
(E)-4-N-[(Z,1R,2R)-1-[[(3R)-6-[1-(chloroamino)cyclobutyl]hexan-3-yl]-methylamino]-2-propylpent-3-enyl]-1-N'-heptylbut-1-ene-1,1,4-triamine (PubChem CID 89318030) has the molecular formula C30H60ClN5 and a molecular weight of 526.30 g/mol. Its IUPAC name is (E)-4-N-[(Z,1R,2R)-1-[[(3R)-6-[1-(chloroamino)cyclobutyl]hexan-3-yl]-methylamino]-2-propylpent-3-enyl]-1-N'-heptylbut-1-ene-1,1,4-triamine.
| Compound Name | (E)-4-N-[(Z,1R,2R)-1-[[(3R)-6-[1-(chloroamino)cyclobutyl]hexan-3-yl]-methylamino]-2-propylpent-3-enyl]-1-N'-heptylbut-1-ene-1,1,4-triamine |
|---|---|
| PubChem CID | 89318030 |
| Molecular Formula | C30H60ClN5 |
| Molecular Weight | 526.30 g/mol |
| Exact Mass | 525.45 |
| IUPAC Name | (E)-4-N-[(Z,1R,2R)-1-[[(3R)-6-[1-(chloroamino)cyclobutyl]hexan-3-yl]-methylamino]-2-propylpent-3-enyl]-1-N'-heptylbut-1-ene-1,1,4-triamine |
| SMILES | C/C=C\[C@@H](CCC)[C@H](NCC/C=C(\N)NCCCCCCC)N(C)[C@H](CC)CCCC1(NCl)CCC1 |
| InChI | InChI=1S/C30H60ClN5/c1-6-10-11-12-13-24-33-28(32)20-15-25-34-29(26(17-7-2)18-8-3)36(5)27(9-4)19-14-21-30(35-31)22-16-23-30/h7,17,20,26-27,29,33-35H,6,8-16,18-19,21-25,32H2,1-5H3/b17-7-,28-20+/t26-,27+,29+/m0/s1 |
| InChIKey | WUYMHYIMYAGEHI-SQFSBAPVSA-N |
| XLogP | 7.19 |
| TPSA | 65.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.30 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|