About (2S)-N-chloro-1,1-dimethoxy-N,3-dimethylbutan-2-amine
(2S)-N-chloro-1,1-dimethoxy-N,3-dimethylbutan-2-amine (PubChem CID 89318033) has the molecular formula C8H18ClNO2
and a molecular weight of 195.69 g/mol. Its IUPAC name is (2S)-N-chloro-1,1-dimethoxy-N,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | (2S)-N-chloro-1,1-dimethoxy-N,3-dimethylbutan-2-amine |
| PubChem CID | 89318033 |
| Molecular Formula | C8H18ClNO2 |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | (2S)-N-chloro-1,1-dimethoxy-N,3-dimethylbutan-2-amine |
| SMILES | COC(OC)[C@H](C(C)C)N(C)Cl |
| InChI | InChI=1S/C8H18ClNO2/c1-6(2)7(10(3)9)8(11-4)12-5/h6-8H,1-5H3/t7-/m0/s1 |
| InChIKey | WMTCNYIWHHRGDI-ZETCQYMHSA-N |
| XLogP | 1.72 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N-chloro-1,1-dimethoxy-N,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-chloro-1,1-dimethoxy-N,3-dimethylbutan-2-amine?
The IUPAC name of (2S)-N-chloro-1,1-dimethoxy-N,3-dimethylbutan-2-amine (CID 89318033) is (2S)-N-chloro-1,1-dimethoxy-N,3-dimethylbutan-2-amine.
What is the SMILES notation for (2S)-N-chloro-1,1-dimethoxy-N,3-dimethylbutan-2-amine?
The canonical SMILES for (2S)-N-chloro-1,1-dimethoxy-N,3-dimethylbutan-2-amine is COC(OC)[C@H](C(C)C)N(C)Cl.
What is the InChIKey of (2S)-N-chloro-1,1-dimethoxy-N,3-dimethylbutan-2-amine?
The InChIKey is WMTCNYIWHHRGDI-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H18ClNO2/c1-6(2)7(10(3)9)8(11-4)12-5/h6-8H,1-5H3/t7-/m0/s1.
What are the key properties of (2S)-N-chloro-1,1-dimethoxy-N,3-dimethylbutan-2-amine?
(2S)-N-chloro-1,1-dimethoxy-N,3-dimethylbutan-2-amine has a molecular weight of 195.69 g/mol, XLogP of 1.72, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-chloro-1,1-dimethoxy-N,3-dimethylbutan-2-amine is sourced from PubChem (CID 89318033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).