C12H20FN — CID 89318078
(2R,4Z,6Z)-6-ethyl-8-fluoro-5-methyl-3-methylideneocta-4,6-dien-2-amine (PubChem CID 89318078) has the molecular formula C12H20FN and a molecular weight of 197.30 g/mol. Its IUPAC name is (2R,4Z,6Z)-6-ethyl-8-fluoro-5-methyl-3-methylideneocta-4,6-dien-2-amine.
| Compound Name | (2R,4Z,6Z)-6-ethyl-8-fluoro-5-methyl-3-methylideneocta-4,6-dien-2-amine |
|---|---|
| PubChem CID | 89318078 |
| Molecular Formula | C12H20FN |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | (2R,4Z,6Z)-6-ethyl-8-fluoro-5-methyl-3-methylideneocta-4,6-dien-2-amine |
| SMILES | C=C(/C=C(C)\C(=C/CF)CC)[C@@H](C)N |
| InChI | InChI=1S/C12H20FN/c1-5-12(6-7-13)10(3)8-9(2)11(4)14/h6,8,11H,2,5,7,14H2,1,3-4H3/b10-8-,12-6-/t11-/m1/s1 |
| InChIKey | ZOULYJYVMKXMRM-FKUNRITMSA-N |
| XLogP | 3.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|