C10H20N2 — CID 89318104
N',N'-dimethyl-N-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine (PubChem CID 89318104) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is N',N'-dimethyl-N-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 89318104 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N',N'-dimethyl-N-[(2E)-4-methylpenta-2,4-dien-2-yl]ethane-1,2-diamine |
| SMILES | C=C(C)/C=C(\C)NCCN(C)C |
| InChI | InChI=1S/C10H20N2/c1-9(2)8-10(3)11-6-7-12(4)5/h8,11H,1,6-7H2,2-5H3/b10-8+ |
| InChIKey | VIVFWVZXAMURFQ-CSKARUKUSA-N |
| XLogP | 1.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|