C8H10N2O2 — CID 89318111
2-amino-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 89318111) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-amino-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-amino-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 89318111 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 2-amino-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | NN1C(=O)C2=C(CCCC2)C1=O |
| InChI | InChI=1S/C8H10N2O2/c9-10-7(11)5-3-1-2-4-6(5)8(10)12/h1-4,9H2 |
| InChIKey | CKGOWAMROJMXFI-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|