C23H24N2O4 — CID 89318221
prop-2-enyl 1,4-dibenzoyl-2-methylpiperazine-2-carboxylate (PubChem CID 89318221) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is prop-2-enyl 1,4-dibenzoyl-2-methylpiperazine-2-carboxylate.
| Compound Name | prop-2-enyl 1,4-dibenzoyl-2-methylpiperazine-2-carboxylate |
|---|---|
| PubChem CID | 89318221 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | prop-2-enyl 1,4-dibenzoyl-2-methylpiperazine-2-carboxylate |
| SMILES | C=CCOC(=O)C1(C)CN(C(=O)c2ccccc2)CCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O4/c1-3-16-29-22(28)23(2)17-24(20(26)18-10-6-4-7-11-18)14-15-25(23)21(27)19-12-8-5-9-13-19/h3-13H,1,14-17H2,2H3 |
| InChIKey | LCDAOZFJEUFDSN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|