About 1-[(5R)-2-fluoro-5-methylcyclohexa-1,3-dien-1-yl]ethanamine
1-[(5R)-2-fluoro-5-methylcyclohexa-1,3-dien-1-yl]ethanamine (PubChem CID 89318381) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is 1-[(5R)-2-fluoro-5-methylcyclohexa-1,3-dien-1-yl]ethanamine.
Molecular Properties
| Compound Name | 1-[(5R)-2-fluoro-5-methylcyclohexa-1,3-dien-1-yl]ethanamine |
| PubChem CID | 89318381 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 1-[(5R)-2-fluoro-5-methylcyclohexa-1,3-dien-1-yl]ethanamine |
| SMILES | CC(N)C1=C(F)C=C[C@H](C)C1 |
| InChI | InChI=1S/C9H14FN/c1-6-3-4-9(10)8(5-6)7(2)11/h3-4,6-7H,5,11H2,1-2H3/t6-,7?/m0/s1 |
| InChIKey | MQBFEYOHUHLVTG-PKPIPKONSA-N |
| XLogP | 2.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(5R)-2-fluoro-5-methylcyclohexa-1,3-dien-1-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5R)-2-fluoro-5-methylcyclohexa-1,3-dien-1-yl]ethanamine?
The IUPAC name of 1-[(5R)-2-fluoro-5-methylcyclohexa-1,3-dien-1-yl]ethanamine (CID 89318381) is 1-[(5R)-2-fluoro-5-methylcyclohexa-1,3-dien-1-yl]ethanamine.
What is the SMILES notation for 1-[(5R)-2-fluoro-5-methylcyclohexa-1,3-dien-1-yl]ethanamine?
The canonical SMILES for 1-[(5R)-2-fluoro-5-methylcyclohexa-1,3-dien-1-yl]ethanamine is CC(N)C1=C(F)C=C[C@H](C)C1.
What is the InChIKey of 1-[(5R)-2-fluoro-5-methylcyclohexa-1,3-dien-1-yl]ethanamine?
The InChIKey is MQBFEYOHUHLVTG-PKPIPKONSA-N. The full InChI is InChI=1S/C9H14FN/c1-6-3-4-9(10)8(5-6)7(2)11/h3-4,6-7H,5,11H2,1-2H3/t6-,7?/m0/s1.
What are the key properties of 1-[(5R)-2-fluoro-5-methylcyclohexa-1,3-dien-1-yl]ethanamine?
1-[(5R)-2-fluoro-5-methylcyclohexa-1,3-dien-1-yl]ethanamine has a molecular weight of 155.22 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5R)-2-fluoro-5-methylcyclohexa-1,3-dien-1-yl]ethanamine is sourced from PubChem (CID 89318381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).