About 2-(2-aminohexyl)nonanoic acid
2-(2-aminohexyl)nonanoic acid (PubChem CID 89318404) has the molecular formula C15H31NO2
and a molecular weight of 257.42 g/mol. Its IUPAC name is 2-(2-aminohexyl)nonanoic acid.
Molecular Properties
| Compound Name | 2-(2-aminohexyl)nonanoic acid |
| PubChem CID | 89318404 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | 2-(2-aminohexyl)nonanoic acid |
| SMILES | CCCCCCCC(CC(N)CCCC)C(=O)O |
| InChI | InChI=1S/C15H31NO2/c1-3-5-7-8-9-10-13(15(17)18)12-14(16)11-6-4-2/h13-14H,3-12,16H2,1-2H3,(H,17,18) |
| InChIKey | WPNSTPCGLKHCEG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminohexyl)nonanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminohexyl)nonanoic acid?
The IUPAC name of 2-(2-aminohexyl)nonanoic acid (CID 89318404) is 2-(2-aminohexyl)nonanoic acid.
What is the SMILES notation for 2-(2-aminohexyl)nonanoic acid?
The canonical SMILES for 2-(2-aminohexyl)nonanoic acid is CCCCCCCC(CC(N)CCCC)C(=O)O.
What is the InChIKey of 2-(2-aminohexyl)nonanoic acid?
The InChIKey is WPNSTPCGLKHCEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO2/c1-3-5-7-8-9-10-13(15(17)18)12-14(16)11-6-4-2/h13-14H,3-12,16H2,1-2H3,(H,17,18).
What are the key properties of 2-(2-aminohexyl)nonanoic acid?
2-(2-aminohexyl)nonanoic acid has a molecular weight of 257.42 g/mol, XLogP of 3.96, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminohexyl)nonanoic acid is sourced from PubChem (CID 89318404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).