C11H17FO2 — CID 89318711
(3E,5Z)-7-fluoro-4-(3-methoxypropoxy)hepta-1,3,5-triene (PubChem CID 89318711) has the molecular formula C11H17FO2 and a molecular weight of 200.25 g/mol. Its IUPAC name is (3E,5Z)-7-fluoro-4-(3-methoxypropoxy)hepta-1,3,5-triene.
| Compound Name | (3E,5Z)-7-fluoro-4-(3-methoxypropoxy)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 89318711 |
| Molecular Formula | C11H17FO2 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (3E,5Z)-7-fluoro-4-(3-methoxypropoxy)hepta-1,3,5-triene |
| SMILES | C=C/C=C(\C=C/CF)OCCCOC |
| InChI | InChI=1S/C11H17FO2/c1-3-6-11(7-4-8-12)14-10-5-9-13-2/h3-4,6-7H,1,5,8-10H2,2H3/b7-4-,11-6+ |
| InChIKey | RDLGLOFCUKWPLS-MBHGMHKNSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|