C12H19FO2 — CID 89318777
(2E,4E,6Z)-2-fluoro-5-(3-methoxypropoxy)octa-2,4,6-triene (PubChem CID 89318777) has the molecular formula C12H19FO2 and a molecular weight of 214.28 g/mol. Its IUPAC name is (2E,4E,6Z)-2-fluoro-5-(3-methoxypropoxy)octa-2,4,6-triene.
| Compound Name | (2E,4E,6Z)-2-fluoro-5-(3-methoxypropoxy)octa-2,4,6-triene |
|---|---|
| PubChem CID | 89318777 |
| Molecular Formula | C12H19FO2 |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (2E,4E,6Z)-2-fluoro-5-(3-methoxypropoxy)octa-2,4,6-triene |
| SMILES | C/C=C\C(=C/C=C(\C)F)OCCCOC |
| InChI | InChI=1S/C12H19FO2/c1-4-6-12(8-7-11(2)13)15-10-5-9-14-3/h4,6-8H,5,9-10H2,1-3H3/b6-4-,11-7+,12-8+ |
| InChIKey | HJDSXCKEECEVNJ-ABPJNWLSSA-N |
| XLogP | 3.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|