C17H21N5O2S — CID 89318871
4-cyclohexyl-3-(2,4-dinitroso-5-propan-2-ylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 89318871) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is 4-cyclohexyl-3-(2,4-dinitroso-5-propan-2-ylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-cyclohexyl-3-(2,4-dinitroso-5-propan-2-ylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 89318871 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 4-cyclohexyl-3-(2,4-dinitroso-5-propan-2-ylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)c1cc(-c2n[nH]c(=S)n2C2CCCCC2)c(N=O)cc1N=O |
| InChI | InChI=1S/C17H21N5O2S/c1-10(2)12-8-13(15(21-24)9-14(12)20-23)16-18-19-17(25)22(16)11-6-4-3-5-7-11/h8-11H,3-7H2,1-2H3,(H,19,25) |
| InChIKey | ARKIPRAKZZQHPU-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|