C20H18O4 — CID 89319024
dimethyl 2-[(E)-3-cyclohexa-1,5-dien-3-yn-1-yl-1-phenylprop-2-enyl]propanedioate (PubChem CID 89319024) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is dimethyl 2-[(E)-3-cyclohexa-1,5-dien-3-yn-1-yl-1-phenylprop-2-enyl]propanedioate.
| Compound Name | dimethyl 2-[(E)-3-cyclohexa-1,5-dien-3-yn-1-yl-1-phenylprop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 89319024 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | dimethyl 2-[(E)-3-cyclohexa-1,5-dien-3-yn-1-yl-1-phenylprop-2-enyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C(/C=C/c1cc#ccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18O4/c1-23-19(21)18(20(22)24-2)17(16-11-7-4-8-12-16)14-13-15-9-5-3-6-10-15/h4-5,7-14,17-18H,1-2H3/b14-13+ |
| InChIKey | UALZJQODDJFYOX-BUHFOSPRSA-N |
| XLogP | 3.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|