C16H13F2N5 — CID 89319036
1-[(3,4-difluorophenyl)methyl]-N-hydrazinylideneindole-5-carboximidamide (PubChem CID 89319036) has the molecular formula C16H13F2N5 and a molecular weight of 313.31 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-N-hydrazinylideneindole-5-carboximidamide.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-N-hydrazinylideneindole-5-carboximidamide |
|---|---|
| PubChem CID | 89319036 |
| Molecular Formula | C16H13F2N5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-N-hydrazinylideneindole-5-carboximidamide |
| SMILES | [H]/N=C(\N=N\N)c1ccc2c(ccn2Cc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C16H13F2N5/c17-13-3-1-10(7-14(13)18)9-23-6-5-11-8-12(2-4-15(11)23)16(19)21-22-20/h1-8H,9H2,(H3,19,20,21) |
| InChIKey | KVHDXDXDXBOVEO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|