C11H19NO — CID 89319215
(2Z,4Z)-6-butan-2-yloxyhepta-2,4,6-trien-1-amine (PubChem CID 89319215) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (2Z,4Z)-6-butan-2-yloxyhepta-2,4,6-trien-1-amine.
| Compound Name | (2Z,4Z)-6-butan-2-yloxyhepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 89319215 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (2Z,4Z)-6-butan-2-yloxyhepta-2,4,6-trien-1-amine |
| SMILES | C=C(/C=C\C=C/CN)OC(C)CC |
| InChI | InChI=1S/C11H19NO/c1-4-10(2)13-11(3)8-6-5-7-9-12/h5-8,10H,3-4,9,12H2,1-2H3/b7-5-,8-6- |
| InChIKey | ZRBMIHSNAUZPSM-SFECMWDFSA-N |
| XLogP | 2.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|