About 4-[(Z)-but-2-enyl]-2,4-dimethyl-5-methylidene-1,3-thiazole
4-[(Z)-but-2-enyl]-2,4-dimethyl-5-methylidene-1,3-thiazole (PubChem CID 89319226) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is 4-[(Z)-but-2-enyl]-2,4-dimethyl-5-methylidene-1,3-thiazole.
Molecular Properties
| Compound Name | 4-[(Z)-but-2-enyl]-2,4-dimethyl-5-methylidene-1,3-thiazole |
| PubChem CID | 89319226 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 4-[(Z)-but-2-enyl]-2,4-dimethyl-5-methylidene-1,3-thiazole |
| SMILES | C=C1SC(C)=NC1(C)C/C=C\C |
| InChI | InChI=1S/C10H15NS/c1-5-6-7-10(4)8(2)12-9(3)11-10/h5-6H,2,7H2,1,3-4H3/b6-5- |
| InChIKey | RHCRUBAJXRNULG-WAYWQWQTSA-N |
| XLogP | 3.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-but-2-enyl]-2,4-dimethyl-5-methylidene-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-but-2-enyl]-2,4-dimethyl-5-methylidene-1,3-thiazole?
The IUPAC name of 4-[(Z)-but-2-enyl]-2,4-dimethyl-5-methylidene-1,3-thiazole (CID 89319226) is 4-[(Z)-but-2-enyl]-2,4-dimethyl-5-methylidene-1,3-thiazole.
What is the SMILES notation for 4-[(Z)-but-2-enyl]-2,4-dimethyl-5-methylidene-1,3-thiazole?
The canonical SMILES for 4-[(Z)-but-2-enyl]-2,4-dimethyl-5-methylidene-1,3-thiazole is C=C1SC(C)=NC1(C)C/C=C\C.
What is the InChIKey of 4-[(Z)-but-2-enyl]-2,4-dimethyl-5-methylidene-1,3-thiazole?
The InChIKey is RHCRUBAJXRNULG-WAYWQWQTSA-N. The full InChI is InChI=1S/C10H15NS/c1-5-6-7-10(4)8(2)12-9(3)11-10/h5-6H,2,7H2,1,3-4H3/b6-5-.
What are the key properties of 4-[(Z)-but-2-enyl]-2,4-dimethyl-5-methylidene-1,3-thiazole?
4-[(Z)-but-2-enyl]-2,4-dimethyl-5-methylidene-1,3-thiazole has a molecular weight of 181.30 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-but-2-enyl]-2,4-dimethyl-5-methylidene-1,3-thiazole is sourced from PubChem (CID 89319226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).