About 2-O-(cyclopenta-1,3-diene-1-carbonyl) 1-O-ethyl oxalate
2-O-(cyclopenta-1,3-diene-1-carbonyl) 1-O-ethyl oxalate (PubChem CID 89319367) has the molecular formula C10H10O5
and a molecular weight of 210.18 g/mol. Its IUPAC name is 2-O-(cyclopenta-1,3-diene-1-carbonyl) 1-O-ethyl oxalate.
Molecular Properties
| Compound Name | 2-O-(cyclopenta-1,3-diene-1-carbonyl) 1-O-ethyl oxalate |
| PubChem CID | 89319367 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 2-O-(cyclopenta-1,3-diene-1-carbonyl) 1-O-ethyl oxalate |
| SMILES | CCOC(=O)C(=O)OC(=O)C1=CC=CC1 |
| InChI | InChI=1S/C10H10O5/c1-2-14-9(12)10(13)15-8(11)7-5-3-4-6-7/h3-5H,2,6H2,1H3 |
| InChIKey | BCWDGJQSWFUCQI-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-O-(cyclopenta-1,3-diene-1-carbonyl) 1-O-ethyl oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-(cyclopenta-1,3-diene-1-carbonyl) 1-O-ethyl oxalate?
The IUPAC name of 2-O-(cyclopenta-1,3-diene-1-carbonyl) 1-O-ethyl oxalate (CID 89319367) is 2-O-(cyclopenta-1,3-diene-1-carbonyl) 1-O-ethyl oxalate.
What is the SMILES notation for 2-O-(cyclopenta-1,3-diene-1-carbonyl) 1-O-ethyl oxalate?
The canonical SMILES for 2-O-(cyclopenta-1,3-diene-1-carbonyl) 1-O-ethyl oxalate is CCOC(=O)C(=O)OC(=O)C1=CC=CC1.
What is the InChIKey of 2-O-(cyclopenta-1,3-diene-1-carbonyl) 1-O-ethyl oxalate?
The InChIKey is BCWDGJQSWFUCQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O5/c1-2-14-9(12)10(13)15-8(11)7-5-3-4-6-7/h3-5H,2,6H2,1H3.
What are the key properties of 2-O-(cyclopenta-1,3-diene-1-carbonyl) 1-O-ethyl oxalate?
2-O-(cyclopenta-1,3-diene-1-carbonyl) 1-O-ethyl oxalate has a molecular weight of 210.18 g/mol, XLogP of 0.51, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-(cyclopenta-1,3-diene-1-carbonyl) 1-O-ethyl oxalate is sourced from PubChem (CID 89319367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).