C24H26F3N3O3 — CID 89319429
5-amino-N-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-1-[[3-(trifluoromethoxy)phenyl]methyl]indole-2-carboxamide (PubChem CID 89319429) has the molecular formula C24H26F3N3O3 and a molecular weight of 461.48 g/mol. Its IUPAC name is 5-amino-N-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-1-[[3-(trifluoromethoxy)phenyl]methyl]indole-2-carboxamide.
| Compound Name | 5-amino-N-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-1-[[3-(trifluoromethoxy)phenyl]methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 89319429 |
| Molecular Formula | C24H26F3N3O3 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 5-amino-N-[[(1R,2S)-2-hydroxycyclohexyl]methyl]-1-[[3-(trifluoromethoxy)phenyl]methyl]indole-2-carboxamide |
| SMILES | Nc1ccc2c(c1)cc(C(=O)NC[C@H]1CCCC[C@@H]1O)n2Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C24H26F3N3O3/c25-24(26,27)33-19-6-3-4-15(10-19)14-30-20-9-8-18(28)11-17(20)12-21(30)23(32)29-13-16-5-1-2-7-22(16)31/h3-4,6,8-12,16,22,31H,1-2,5,7,13-14,28H2,(H,29,32)/t16-,22+/m1/s1 |
| InChIKey | HKCVFOKMGJIBRN-ZHRRBRCNSA-N |
| XLogP | 4.45 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|